EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O4 |
| Net Charge | 0 |
| Average Mass | 324.336 |
| Monoisotopic Mass | 324.11101 |
| SMILES | O=C1N[C@H]2Cc3ccc(O)c(c3)-c3cc(ccc3O)C[C@@H]1NC2=O |
| InChI | InChI=1S/C18H16N2O4/c21-15-3-1-9-5-11(15)12-6-10(2-4-16(12)22)8-14-18(24)19-13(7-9)17(23)20-14/h1-6,13-14,21-22H,7-8H2,(H,19,24)(H,20,23)/t13-,14-/m0/s1 |
| InChIKey | PYDUENRHWXNYLP-KBPBESRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mycocyclosin (CHEBI:71596) has functional parent cyclo(L-tyrosyl-L-tyrosyl) (CHEBI:65063) |
| mycocyclosin (CHEBI:71596) has role metabolite (CHEBI:25212) |
| mycocyclosin (CHEBI:71596) is a 2,5-diketopiperazines (CHEBI:65061) |
| mycocyclosin (CHEBI:71596) is a organic heterotetracyclic compound (CHEBI:38163) |
| mycocyclosin (CHEBI:71596) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (1S,14S)-6,9-dihydroxy-15,17-diazatetracyclo[12.2.2.13,7.18,12]icosa-3(20),4,6,8(19),9,11-hexaene-16,18-dione |
| UniProt Name | Source |
|---|---|
| mycoclysin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22555887 | Reaxys |
| Citations |
|---|