EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O4 |
| Net Charge | 0 |
| Average Mass | 326.352 |
| Monoisotopic Mass | 326.12666 |
| SMILES | O=C1N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@H]1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H18N2O4/c21-13-5-1-11(2-6-13)9-15-17(23)20-16(18(24)19-15)10-12-3-7-14(22)8-4-12/h1-8,15-16,21-22H,9-10H2,(H,19,24)(H,20,23)/t15-,16-/m0/s1 |
| InChIKey | NGPCLOGFGKJCBP-HOTGVXAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(L-tyrosyl-L-tyrosyl) (CHEBI:65063) has role metabolite (CHEBI:25212) |
| cyclo(L-tyrosyl-L-tyrosyl) (CHEBI:65063) is a cyclo(tyrosyl-tyrosyl) (CHEBI:65048) |
| Incoming Relation(s) |
| mycocyclosin (CHEBI:71596) has functional parent cyclo(L-tyrosyl-L-tyrosyl) (CHEBI:65063) |
| IUPAC Name |
|---|
| (3S,6S)-3,6-bis(4-hydroxybenzyl)piperazine-2,5-dione |
| Synonyms | Source |
|---|---|
| cyclo(Tyr-Tyr) | ChEBI |
| cyclo(L-tyrosyl-L-tyrosine) | ChEBI |
| cyclo-(L-Tyr-L-Tyr) | ChEBI |
| cyclo-(L-Tyr)2 | ChEBI |
| cyclo-(L-tyrosyl-L-tyrosine) | ChEBI |
| (3S)-cis-3,6-bis-(4-hydroxy-benzyl)-piperazine-2,5-dione | ChEBI |
| UniProt Name | Source |
|---|---|
| cyclo(L-tyrosyl-L-tyrosyl) | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:94441 | Reaxys |
| CAS:10125-11-8 | Reaxys |
| Citations |
|---|