EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17O7 |
| Net Charge | -1 |
| Average Mass | 369.349 |
| Monoisotopic Mass | 369.09798 |
| SMILES | CCCCCC(=O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc([O-])cc1C2=O |
| InChI | InChI=1S/C20H18O7/c1-2-3-4-5-12(22)17-14(24)8-11-16(20(17)27)19(26)15-10(18(11)25)6-9(21)7-13(15)23/h6-8,21,23-24,27H,2-5H2,1H3/p-1 |
| InChIKey | XIJDBHLQUYAZJI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norsolorinate(1−) (CHEBI:71533) is a organic anion (CHEBI:25696) |
| norsolorinate(1−) (CHEBI:71533) is conjugate acid of norsolorinate(2−) (CHEBI:71346) |
| norsolorinate(1−) (CHEBI:71533) is conjugate base of norsolorinic acid (CHEBI:71356) |
| Incoming Relation(s) |
| norsolorinic acid (CHEBI:71356) is conjugate acid of norsolorinate(1−) (CHEBI:71533) |
| norsolorinate(2−) (CHEBI:71346) is conjugate base of norsolorinate(1−) (CHEBI:71533) |
| IUPAC Name |
|---|
| 6-hexanoyl-4,5,7-trihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-olate |
| UniProt Name | Source |
|---|---|
| norsolorinic acid | UniProt |