EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O7 |
| Net Charge | 0 |
| Average Mass | 370.357 |
| Monoisotopic Mass | 370.10525 |
| SMILES | CCCCCC(=O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C20H18O7/c1-2-3-4-5-12(22)17-14(24)8-11-16(20(17)27)19(26)15-10(18(11)25)6-9(21)7-13(15)23/h6-8,21,23-24,27H,2-5H2,1H3 |
| InChIKey | XIJDBHLQUYAZJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norsolorinic acid (CHEBI:71356) has role fungal metabolite (CHEBI:76946) |
| norsolorinic acid (CHEBI:71356) is a polyketide (CHEBI:26188) |
| norsolorinic acid (CHEBI:71356) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| norsolorinic acid (CHEBI:71356) is conjugate acid of norsolorinate(1−) (CHEBI:71533) |
| Incoming Relation(s) |
| norsolorinate(1−) (CHEBI:71533) is conjugate base of norsolorinic acid (CHEBI:71356) |
| IUPAC Name |
|---|
| 2-hexanoyl-1,3,6,8-tetrahydroxy-9,10-anthraquinone |
| Manual Xrefs | Databases |
|---|---|
| CPD-10162 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2065177 | Reaxys |
| CAS:10254-99-6 | ChemIDplus |
| Citations |
|---|