EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44N2O5 |
| Net Charge | 0 |
| Average Mass | 428.614 |
| Monoisotopic Mass | 428.32502 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@H](C)CCC[C@H](CC)CCCNC(=O)[C@@H]2C)O[C@@H](C)[C@@H](O)[C@@H](N)[C@H]1O |
| InChI | InChI=1S/C23H44N2O5/c1-5-17-9-6-8-14(2)11-12-18(15(3)22(28)25-13-7-10-17)30-23-21(27)19(24)20(26)16(4)29-23/h14-21,23,26-27H,5-13,24H2,1-4H3,(H,25,28)/t14-,15-,16+,17+,18+,19-,20-,21-,23+/m1/s1 |
| InChIKey | ZRJBXPCQRSLIKK-BDPAYSQHSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | EC 3.2.1.18 (exo-alpha-sialidase) inhibitor An antiviral drug targeted at influenza viruses. Its mode of action consists of blocking the function of the viral neuraminidase protein (EC 3.2.1.18), thus preventing the virus from budding from the host cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluvirucin A1 (CHEBI:71508) has role antimicrobial agent (CHEBI:33281) |
| fluvirucin A1 (CHEBI:71508) has role EC 3.2.1.18 (exo-α-sialidase) inhibitor (CHEBI:52425) |
| fluvirucin A1 (CHEBI:71508) has role metabolite (CHEBI:25212) |
| fluvirucin A1 (CHEBI:71508) is a aminoglycoside (CHEBI:47779) |
| fluvirucin A1 (CHEBI:71508) is a lactam (CHEBI:24995) |
| fluvirucin A1 (CHEBI:71508) is a macrocycle (CHEBI:51026) |
| Incoming Relation(s) |
| N-methylfluvirucin A1 (CHEBI:65750) has functional parent fluvirucin A1 (CHEBI:71508) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) has functional parent fluvirucin A1 (CHEBI:71508) |
| IUPAC Name |
|---|
| (3R,4S,7R,11S)-11-ethyl-3,7-dimethyl-2-oxoazacyclotetradecan-4-yl 3-amino-3,6-dideoxy-α-L-talopyranoside |
| Synonym | Source |
|---|---|
| (2R,3S,6R,10S)-3-[(3-amino-3,6-dideoxy-α-L-talopyranosyl)-oxy]-2,6-dimethyl-10-ethyl-13-tridecanelactam | ChEBI |
| Citations |
|---|