EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44N2O5 |
| Net Charge | 0 |
| Average Mass | 428.614 |
| Monoisotopic Mass | 428.32502 |
| SMILES | [H][C@@]1(O[C@H]2CCCCCC[C@H](CC)CCCNC(=O)[C@@H]2C)O[C@@H](C)[C@@H](O)[C@@H](NC)[C@H]1O |
| InChI | InChI=1S/C23H44N2O5/c1-5-17-11-8-6-7-9-13-18(15(2)22(28)25-14-10-12-17)30-23-21(27)19(24-4)20(26)16(3)29-23/h15-21,23-24,26-27H,5-14H2,1-4H3,(H,25,28)/t15-,16+,17+,18+,19-,20-,21-,23+/m1/s1 |
| InChIKey | XKCKFIWDRHTTCA-LKRNETLMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nonomuraea turkmeniaca (ncbitaxon:103838) | - | PubMed (17636954) | Strain: MA7364 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) has functional parent fluvirucin A1 (CHEBI:71508) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) has role anthelminthic drug (CHEBI:35443) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) has role metabolite (CHEBI:25212) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) is a aminoglycoside (CHEBI:47779) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) is a lactam (CHEBI:24995) |
| 6-desmethyl-N-methylfluvirucin A1 (CHEBI:65749) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (3R,4S,11S)-11-ethyl-3-methyl-2-oxoazacyclotetradecan-4-yl 3,6-dideoxy-3-(methylamino)-α-L-talopyranoside |
| Synonym | Source |
|---|---|
| 3-[(3-methylamino-3,6-dideoxy-α-L-talopyranosyl)oxy]-2-methyl-10-ethyl-13-tridecanolactam | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11289518 | Reaxys |
| Citations |
|---|