EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CCC(=C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,18,20-24,31-33H,1,8-16H2,2-6H3,(H,34,35)/t18-,20+,21+,22+,23-,24-,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | FFMVHFPLIIYYNC-QXIFDOFRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinidic acid (CHEBI:71457) has parent hydride ursane (CHEBI:35711) |
| actinidic acid (CHEBI:71457) has role metabolite (CHEBI:25212) |
| actinidic acid (CHEBI:71457) has role phytoalexin (CHEBI:26115) |
| actinidic acid (CHEBI:71457) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| actinidic acid (CHEBI:71457) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has functional parent actinidic acid (CHEBI:71457) |
| IUPAC Name |
|---|
| (2α,3β)-2,3,23-trihydroxyursa-12,20(30)-dien-28-oic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037963 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8886569 | Reaxys |
| Citations |
|---|