EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H52O7 |
| Net Charge | 0 |
| Average Mass | 632.838 |
| Monoisotopic Mass | 632.37130 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CCC(=C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)cc2)[C@@]1(C)CO |
| InChI | InChI=1S/C39H52O7/c1-23-15-18-39(34(44)45)20-19-37(5)27(32(39)24(23)2)12-13-30-35(3)21-28(42)33(36(4,22-40)29(35)16-17-38(30,37)6)46-31(43)14-9-25-7-10-26(41)11-8-25/h7-12,14,24,28-30,32-33,40-42H,1,13,15-22H2,2-6H3,(H,44,45)/b14-9+/t24-,28+,29+,30+,32-,33-,35-,36-,37+,38+,39-/m0/s1 |
| InChIKey | IFPMSAOPSQVFLA-VYXVHPRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinidia arguta (ncbitaxon:64478) | root (BTO:0001188) | PubMed (18481026) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has functional parent actinidic acid (CHEBI:71457) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has role metabolite (CHEBI:25212) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a cinnamate ester (CHEBI:36087) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a pentacyclic triterpenoid (CHEBI:25872) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a primary alcohol (CHEBI:15734) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2α,3β)-2,23-dihydroxy-3-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}ursa-12,20(30)-dien-28-oic acid |
| Synonym | Source |
|---|---|
| 3β-(trans-p-coumaroyl)oxy-2α,23-dihydroxyurs-12(13),20(30)-dien-28-oic acid | ChEBI |
| Citations |
|---|