EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H52O7 |
| Net Charge | 0 |
| Average Mass | 632.838 |
| Monoisotopic Mass | 632.37130 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CCC(=C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)cc2)[C@@]1(C)CO |
| InChI | InChI=1S/C39H52O7/c1-23-15-18-39(34(44)45)20-19-37(5)27(32(39)24(23)2)12-13-30-35(3)21-28(42)33(36(4,22-40)29(35)16-17-38(30,37)6)46-31(43)14-9-25-7-10-26(41)11-8-25/h7-12,14,24,28-30,32-33,40-42H,1,13,15-22H2,2-6H3,(H,44,45)/b14-9+/t24-,28+,29+,30+,32-,33-,35-,36-,37+,38+,39-/m0/s1 |
| InChIKey | IFPMSAOPSQVFLA-VYXVHPRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinidia arguta (ncbitaxon:64478) | root (BTO:0001188) | PubMed (18481026) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has functional parent actinidic acid (CHEBI:71457) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) has role metabolite (CHEBI:25212) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a cinnamate ester (CHEBI:36087) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a pentacyclic triterpenoid (CHEBI:25872) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a primary alcohol (CHEBI:15734) |
| 3-O-trans-p-coumaroyl actinidic acid (CHEBI:65661) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2α,3β)-2,23-dihydroxy-3-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}ursa-12,20(30)-dien-28-oic acid |
| Synonym | Source |
|---|---|
| 3β-(trans-p-coumaroyl)oxy-2α,23-dihydroxyurs-12(13),20(30)-dien-28-oic acid | ChEBI |
| Citations |
|---|