EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N5O7P |
| Net Charge | 0 |
| Average Mass | 347.224 |
| Monoisotopic Mass | 347.06308 |
| SMILES | Nc1ncnc2c1nc(=O)n2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H14N5O7P/c11-8-7-9(13-3-12-8)15(10(17)14-7)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H,14,17)(H2,11,12,13)(H2,18,19,20)/t4-,5+,6+/m0/s1 |
| InChIKey | QFGWDFAYOAGQDH-KVQBGUIXSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-oxo-dAMP (CHEBI:71403) has functional parent 2'-deoxyadenosine 5'-monophosphate (CHEBI:17713) |
| 8-oxo-dAMP (CHEBI:71403) is a purine 2'-deoxyribonucleoside 5'-diphosphate (CHEBI:37036) |
| 8-oxo-dAMP (CHEBI:71403) is conjugate acid of 8-oxo-dAMP(2−) (CHEBI:71361) |
| 8-oxo-dAMP (CHEBI:71403) is tautomer of 8-hydroxy-dAMP (CHEBI:70964) |
| Incoming Relation(s) |
| 8-oxo-dAMP(2−) (CHEBI:71361) is conjugate base of 8-oxo-dAMP (CHEBI:71403) |
| 8-hydroxy-dAMP (CHEBI:70964) is tautomer of 8-oxo-dAMP (CHEBI:71403) |
| IUPAC Name |
|---|
| 2'-deoxy-8-oxo-8-hydroadenosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-8-oxoadenosine-5'-phosphate | ChEBI |
| 8-oxo-2'-deoxyadenosine-5'-phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8869265 | Reaxys |