EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O2 |
| Net Charge | 0 |
| Average Mass | 315.417 |
| Monoisotopic Mass | 315.19468 |
| SMILES | [H][C@]12C[C@@H](C#N)N(C(=O)[C@@H](N)C34CC5CC(CC(O)(C5)C3)C4)[C@@]1([H])C2 |
| InChI | InChI=1S/C18H25N3O2/c19-8-13-2-12-3-14(12)21(13)16(22)15(20)17-4-10-1-11(5-17)7-18(23,6-10)9-17/h10-15,23H,1-7,9,20H2/t10?,11?,12-,13+,14+,15-,17?,18?/m1/s1 |
| InChIKey | QGJUIPDUBHWZPV-SGTAVMJGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that specifically inhibits dipeptidyl peptidase-4 (EC 3.4.14.5). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saxagliptin (CHEBI:71272) has role EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor (CHEBI:68612) |
| saxagliptin (CHEBI:71272) has role hypoglycemic agent (CHEBI:35526) |
| saxagliptin (CHEBI:71272) is a adamantanes (CHEBI:51339) |
| saxagliptin (CHEBI:71272) is a azabicycloalkane (CHEBI:38295) |
| saxagliptin (CHEBI:71272) is a monocarboxylic acid amide (CHEBI:29347) |
| saxagliptin (CHEBI:71272) is a nitrile (CHEBI:18379) |
| saxagliptin (CHEBI:71272) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| saxagliptin hydrate (CHEBI:71271) has part saxagliptin (CHEBI:71272) |
| IUPAC Name |
|---|
| (1S,3S,5S)-2-[(2S)-2-amino-2-(3-hydroxyadamantan-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| INN | Source |
|---|---|
| saxagliptin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| BMS-477118 | DrugBank |
| (1S,3S,5S)-2-((2S)-Amino(3-hydroxytricyclo(3.3.1.13,7)dec-1-yl)acetyl)-2-azabicyclo(3.1.0)hexane-3-carbonitrile | ChemIDplus |
| BMS 477118 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB06335 | DrugBank |
| D08996 | KEGG DRUG |
| US2005222242 | Patent |
| WO2011125011 | Patent |
| WO2009022009 | Patent |
| US2007172525 | Patent |
| WO2007078726 | Patent |
| HMDB0015634 | HMDB |
| Saxagliptin | Wikipedia |
| 4114 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10201614 | Reaxys |
| CAS:361442-04-8 | ChemIDplus |
| CAS:361442-04-8 | KEGG DRUG |
| Citations |
|---|