EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O2.H2O |
| Net Charge | 0 |
| Average Mass | 333.432 |
| Monoisotopic Mass | 333.20524 |
| SMILES | O.[H][C@]12C[C@@H](C#N)N(C(=O)[C@@H](N)C34CC5CC(CC(O)(C5)C3)C4)[C@@]1([H])C2 |
| InChI | InChI=1S/C18H25N3O2.H2O/c19-8-13-2-12-3-14(12)21(13)16(22)15(20)17-4-10-1-11(5-17)7-18(23,6-10)9-17;/h10-15,23H,1-7,9,20H2;1H2/t10?,11?,12-,13+,14+,15-,17?,18?;/m1./s1 |
| InChIKey | AFNTWHMDBNQQPX-NHKADLRUSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that specifically inhibits dipeptidyl peptidase-4 (EC 3.4.14.5). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saxagliptin hydrate (CHEBI:71271) has part saxagliptin (CHEBI:71272) |
| saxagliptin hydrate (CHEBI:71271) has role EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor (CHEBI:68612) |
| saxagliptin hydrate (CHEBI:71271) has role hypoglycemic agent (CHEBI:35526) |
| saxagliptin hydrate (CHEBI:71271) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (1S,3S,5S)-2-[(2S)-2-amino-2-(3-hydroxyadamantan-1-yl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile—water (1/1) |
| Synonyms | Source |
|---|---|
| (1S,3S,5S)-2-((2S)-Amino(3-hydroxytricyclo(3.3.1.13,7)dec-1-yl)acetyl)2-azabicyclo(3.1.0)hexane-3-carbonitrile monohydrate | ChemIDplus |
| saxagliptin monohydrate | ChEBI |
| Brand Name | Source |
|---|---|
| Onglyza | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D09753 | KEGG DRUG |
| DB06335 | DrugBank |
| WO2008131149 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18655324 | Reaxys |
| CAS:945667-22-1 | KEGG DRUG |
| CAS:945667-22-1 | ChemIDplus |
| Citations |
|---|