EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N7O5 |
| Net Charge | 0 |
| Average Mass | 477.481 |
| Monoisotopic Mass | 477.17607 |
| SMILES | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H23N7O5/c1-2-3-14(10-15-11-26-20-18(27-15)19(24)29-23(25)30-20)12-4-6-13(7-5-12)21(33)28-16(22(34)35)8-9-17(31)32/h1,4-7,11,14,16H,3,8-10H2,(H,28,33)(H,31,32)(H,34,35)(H4,24,25,26,29,30)/t14?,16-/m0/s1 |
| InChIKey | OGSBUKJUDHAQEA-WMCAAGNKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pralatrexate (CHEBI:71223) has role antimetabolite (CHEBI:35221) |
| pralatrexate (CHEBI:71223) has role antineoplastic agent (CHEBI:35610) |
| pralatrexate (CHEBI:71223) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| pralatrexate (CHEBI:71223) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| pralatrexate (CHEBI:71223) is a pteridines (CHEBI:26373) |
| pralatrexate (CHEBI:71223) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| N-{4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl}-L-glutamic acid |
| INNs | Source |
|---|---|
| pralatrexate | KEGG DRUG |
| pralatrexate | WHO MedNet |
| pralatrexato | WHO MedNet |
| pralatrexatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10-Propargyl-10-deazaaminopterin | KEGG DRUG |
| (2S)-2-({4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl}amino)pentanedioic acid | IUPAC |
| (2S)-2-((4-((1RS)-1-((2,4-Diaminopteridin-6-yl)methyl)but-3-ynyl)benzoyl)amino)pentanedioic acid | ChemIDplus |
| HSDB 7786 | ChemIDplus |
| N-(4-(1-((2,4-Diamino-6-pteridinyl)methyl)-3-butynyl)benzoyl)-L-glutamic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Folotyn | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4117 | DrugCentral |
| D05589 | KEGG DRUG |
| Pralatrexate | Wikipedia |
| US2005267117 | Patent |
| US2011190305 | Patent |
| US6028071 | Patent |
| US6323205 | Patent |
| WO2007023243 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6624234 | Reaxys |
| CAS:146464-95-1 | ChemIDplus |
| CAS:146464-95-1 | KEGG DRUG |
| Citations |
|---|