EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N7O2S.HCl |
| Net Charge | 0 |
| Average Mass | 473.990 |
| Monoisotopic Mass | 473.14007 |
| SMILES | Cc1ccc(Nc2nccc(N(C)c3ccc4c(C)n(C)nc4c3)n2)cc1S(N)(=O)=O.Cl |
| InChI | InChI=1S/C21H23N7O2S.ClH/c1-13-5-6-15(11-19(13)31(22,29)30)24-21-23-10-9-20(25-21)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16;/h5-12H,1-4H3,(H2,22,29,30)(H,23,24,25);1H |
| InChIKey | MQHIQUBXFFAOMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pazopanib hydrochloride (CHEBI:71217) has part pazopanib(1+) (CHEBI:71218) |
| pazopanib hydrochloride (CHEBI:71217) has role angiogenesis modulating agent (CHEBI:50926) |
| pazopanib hydrochloride (CHEBI:71217) has role antineoplastic agent (CHEBI:35610) |
| pazopanib hydrochloride (CHEBI:71217) has role tyrosine kinase inhibitor (CHEBI:38637) |
| pazopanib hydrochloride (CHEBI:71217) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| pazopanib hydrochloride (CHEBI:71217) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 5-({4-[(2,3-dimethyl-2H-indazol-6-yl)(methyl)amino]pyrimidin-2-yl}amino)-2-methylbenzenesulfonamide hydrochloride |
| Synonyms | Source |
|---|---|
| pazopanib HCl | ChEBI |
| 5-((4-((2,3-Dimethyl-2H-indazol-6-yl)methylamino)pyrimidin-2-yl)amino)-2-methylbenzenesulfonamide monohydrochloride | ChemIDplus |
| pazopanib monohydrochloride | ChEBI |
| GW786034B | ChemIDplus |
| Brand Name | Source |
|---|---|
| Votrient | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D05380 | KEGG DRUG |
| WO2009062658 | Patent |
| WO2007064753 | Patent |
| US2008293691 | Patent |
| WO2006020564 | Patent |
| WO2007143483 | Patent |
| WO2005105094 | Patent |
| WO2011150044 | Patent |
| Pazopanib_hydrochloride | Wikipedia |
| WO2011069053 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11572612 | Reaxys |
| CAS:635702-64-6 | KEGG DRUG |
| CAS:635702-64-6 | ChemIDplus |
| Citations |
|---|