EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N6O |
| Net Charge | 0 |
| Average Mass | 312.377 |
| Monoisotopic Mass | 312.16986 |
| SMILES | C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1N(C)c1ncnc2nccc12 |
| InChI | InChI=1S/C16H20N6O/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/t11-,13+/m1/s1 |
| InChIKey | UJLAWZDWDVHWOW-YPMHNXCESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Application: | antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tofacitinib (CHEBI:71200) has role antirheumatic drug (CHEBI:35842) |
| tofacitinib (CHEBI:71200) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| tofacitinib (CHEBI:71200) is a N-acylpiperidine (CHEBI:48591) |
| tofacitinib (CHEBI:71200) is a nitrile (CHEBI:18379) |
| tofacitinib (CHEBI:71200) is a pyrrolopyrimidine (CHEBI:38670) |
| tofacitinib (CHEBI:71200) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| tofacitinib citrate (CHEBI:71197) has part tofacitinib (CHEBI:71200) |
| IUPAC Name |
|---|
| 3-{(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl}-3-oxopropanenitrile |
| INNs | Source |
|---|---|
| tofacitinib | WHO MedNet |
| tofacitinib | WHO MedNet |
| tofacitinib | WHO MedNet |
| tofacitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP 690550 | DrugCentral |
| CP-690550 | DrugCentral |
| Tasocitinib | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4713 | DrugCentral |
| D09970 | KEGG DRUG |
| LSM-1227 | LINCS |
| MI1 | PDBeChem |
| Tofacitinib | Wikipedia |
| WO2007012953 | Patent |
| WO2007107318 | Patent |
| WO2010123919 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11647225 | Reaxys |
| CAS:477600-75-2 | ChemIDplus |
| CAS:477600-75-2 | KEGG DRUG |
| Citations |
|---|