EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N6O.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 504.500 |
| Monoisotopic Mass | 504.19686 |
| SMILES | C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1N(C)c1ncnc2nccc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H20N6O.C6H8O7/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16;7-3(8)1-6(13,5(11)12)2-4(9)10/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t11-,13+;/m1./s1 |
| InChIKey | SYIKUFDOYJFGBQ-YLAFAASESA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Application: | antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tofacitinib citrate (CHEBI:71197) has part tofacitinib (CHEBI:71200) |
| tofacitinib citrate (CHEBI:71197) has role antirheumatic drug (CHEBI:35842) |
| tofacitinib citrate (CHEBI:71197) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| tofacitinib citrate (CHEBI:71197) is a citrate salt (CHEBI:50744) |
| IUPAC Name |
|---|
| 3-{(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl}-3-oxopropanenitrile 2-hydroxypropane-1,2,3-tricarboxylate |
| Synonyms | Source |
|---|---|
| Tasocitinib citrate | KEGG DRUG |
| CP-690,550-10 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Xeljanz | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09783 | KEGG DRUG |
| WO2005063251 | Patent |
| US2003130292 | Patent |
| WO2005105146 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11610699 | Reaxys |
| CAS:540737-29-9 | KEGG DRUG |
| CAS:540737-29-9 | ChemIDplus |
| Citations |
|---|