EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O3R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 319.459 |
| Monoisotopic Mass (excl. R groups) | 319.22732 |
| SMILES | *C1CCC2C3CCC4[C@H](C(=O)O)[C@@H](O)CCC4(C)C3CCC12C |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxy-4α-carboxysteroid (CHEBI:71187) is a 3β-sterol (CHEBI:35348) |
| 3β-hydroxy-4α-carboxysteroid (CHEBI:71187) is a steroid acid (CHEBI:47891) |
| 3β-hydroxy-4α-carboxysteroid (CHEBI:71187) is conjugate acid of 3β-hydroxysteroid-4α-carboxylate (CHEBI:136966) |
| Incoming Relation(s) |
| 3β-hydroxysteroid-4α-carboxylate (CHEBI:136966) is conjugate base of 3β-hydroxy-4α-carboxysteroid (CHEBI:71187) |
| Synonyms | Source |
|---|---|
| 3β-hydroxy-4α-carboxysteroids | ChEBI |
| 3β-hydroxy-4α-carboxy-sterol | SUBMITTER |
| 3β-hydroxysteroid-4α-carboxylic acid | ChEBI |
| 3β-hydroxysteroid-4α-carboxylic acids | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3beta-hydroxy-4alpha-carboxy-sterols | MetaCyc |
| Citations |
|---|