EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3R |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 318.451 |
| Monoisotopic Mass (excl. R groups) | 318.21949 |
| SMILES | *C1CCC2C3CCC4[C@H](C(=O)[O-])[C@@H](O)CCC4(C)C3CCC12C |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxysteroid-4α-carboxylate (CHEBI:136966) is a steroid acid anion (CHEBI:50160) |
| 3β-hydroxysteroid-4α-carboxylate (CHEBI:136966) is conjugate base of 3β-hydroxy-4α-carboxysteroid (CHEBI:71187) |
| Incoming Relation(s) |
| 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate (CHEBI:58387) is a 3β-hydroxysteroid-4α-carboxylate (CHEBI:136966) |
| 3β-hydroxy-4α-carboxysteroid (CHEBI:71187) is conjugate acid of 3β-hydroxysteroid-4α-carboxylate (CHEBI:136966) |
| Synonyms | Source |
|---|---|
| 3β-hydroxy-4α-carboxylato steroid | ChEBI |
| 3β-hydroxy-4α-carboxylato-steroid | ChEBI |
| 3β-hydroxy-4α-carboxylato steroids | ChEBI |
| 3β-hydroxy-4α-carboxylato-steroids | ChEBI |
| 3β-hydroxysteroid-4α-carboxylates | ChEBI |
| UniProt Name | Source |
|---|---|
| a 3β-hydroxysteroid-4α-carboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3beta-hydroxy-4alpha-carboxy-sterols | MetaCyc |
| Citations |
|---|