EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H11NO3/c1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12)(H,13,14) |
| InChIKey | UAQVHNZEONHPQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoylalanine (CHEBI:71167) has role metabolite (CHEBI:25212) |
| N-benzoylalanine (CHEBI:71167) is a N-acyl-amino acid (CHEBI:51569) |
| N-benzoylalanine (CHEBI:71167) is a alanine derivative (CHEBI:22278) |
| Incoming Relation(s) |
| N-benzoyl-L-alanine (CHEBI:71166) is a N-benzoylalanine (CHEBI:71167) |
| Synonyms | Source |
|---|---|
| benzoylalanine | ChEBI |
| Benzoyl-DL-alanine | ChemIDplus |
| dl-N-Benzoylalanine | NIST Chemistry WebBook |
| methylhippuric acid | ChEBI |
| N-Benzoyl-DL-alanine | ChemIDplus |
| α-methylhippuric acid | ChEBI |
| Citations |
|---|