EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | C[C@H](NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H11NO3/c1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | UAQVHNZEONHPQG-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-L-alanine (CHEBI:71166) has role metabolite (CHEBI:25212) |
| N-benzoyl-L-alanine (CHEBI:71166) is a N-acyl-L-alanine (CHEBI:83946) |
| N-benzoyl-L-alanine (CHEBI:71166) is a N-benzoylalanine (CHEBI:71167) |
| IUPAC Name |
|---|
| N-benzoyl-L-alanine |
| Synonyms | Source |
|---|---|
| (S)-α-methylhippuric acid | ChEBI |
| Methylhippuric acid | ChemIDplus |
| N-Benzoylalanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2330961 | Reaxys |
| CAS:2198-64-3 | ChemIDplus |
| Citations |
|---|