EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O5 |
| Net Charge | 0 |
| Average Mass | 190.155 |
| Monoisotopic Mass | 190.05897 |
| SMILES | NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c7-6(13)8-3(5(11)12)1-2-4(9)10/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13)/t3-/m0/s1 |
| InChIKey | LCQLHJZYVOQKHU-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | carbamylphosphate synthetase I activator Any compound that binds and activates the enzyme carbamylphosphate synthetase I. |
| Application: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carglumic acid (CHEBI:71028) has role carbamylphosphate synthetase I activator (CHEBI:71033) |
| carglumic acid (CHEBI:71028) has role orphan drug (CHEBI:71031) |
| carglumic acid (CHEBI:71028) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| carglumic acid (CHEBI:71028) is a ureas (CHEBI:47857) |
| carglumic acid (CHEBI:71028) is conjugate acid of N-carbamoyl-L-glutamate(2−) (CHEBI:229697) |
| Incoming Relation(s) |
| N-carbamoyl-L-glutamate(2−) (CHEBI:229697) is conjugate base of carglumic acid (CHEBI:71028) |
| IUPAC Name |
|---|
| N-carbamoyl-L-glutamic acid |
| INNs | Source |
|---|---|
| carglumic acid | KEGG DRUG |
| ácido carglúmico | WHO MedNet |
| acide carglumique | WHO MedNet |
| acidum carglumicum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Carbamino-L-glutamic acid | ChemIDplus |
| L-N-Carbamoylglutamic acid | ChemIDplus |
| Ureidoglutaric acid | ChemIDplus |
| Carbamylglutamic acid | ChemIDplus |
| (2S)-2-(carbamoylamino)pentanedioic acid | HMDB |
| Brand Name | Source |
|---|---|
| Carbaglu | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D07130 | KEGG DRUG |
| C05829 | KEGG COMPOUND |
| DB06775 | DrugBank |
| HMDB0015673 | HMDB |
| N-CARBAMYL-L-GLUTAMATE | MetaCyc |
| Carglumic_acid | Wikipedia |
| 3068 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727929 | Reaxys |
| CAS:1188-38-1 | KEGG DRUG |
| CAS:1188-38-1 | ChemIDplus |
| CAS:1188-38-1 | KEGG COMPOUND |
| Citations |
|---|