EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H39NO9 |
| Net Charge | 0 |
| Average Mass | 545.629 |
| Monoisotopic Mass | 545.26248 |
| SMILES | [H][C@]12c3cc4c(cc3CCN3CCC[C@@]31C=C(OC)[C@H]2OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)OC)OCO4 |
| InChI | InChI=1S/C29H39NO9/c1-27(2,33)8-5-10-29(34,16-23(31)36-4)26(32)39-25-22(35-3)15-28-9-6-11-30(28)12-7-18-13-20-21(38-17-37-20)14-19(18)24(25)28/h13-15,24-25,33-34H,5-12,16-17H2,1-4H3/t24-,25-,28+,29-/m1/s1 |
| InChIKey | HYFHYPWGAURHIV-JFIAXGOJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| omacetaxine mepesuccinate (CHEBI:71019) has functional parent cephalotaxine (CHEBI:3540) |
| omacetaxine mepesuccinate (CHEBI:71019) has role anticoronaviral agent (CHEBI:149553) |
| omacetaxine mepesuccinate (CHEBI:71019) has role antineoplastic agent (CHEBI:35610) |
| omacetaxine mepesuccinate (CHEBI:71019) has role apoptosis inducer (CHEBI:68495) |
| omacetaxine mepesuccinate (CHEBI:71019) has role protein synthesis inhibitor (CHEBI:48001) |
| omacetaxine mepesuccinate (CHEBI:71019) is a alkaloid ester (CHEBI:38481) |
| omacetaxine mepesuccinate (CHEBI:71019) is a enol ether (CHEBI:47985) |
| omacetaxine mepesuccinate (CHEBI:71019) is a organic heteropentacyclic compound (CHEBI:38164) |
| omacetaxine mepesuccinate (CHEBI:71019) is a tertiary alcohol (CHEBI:26878) |
| INNs | Source |
|---|---|
| mépésuccinate d'omacétaxine | WHO MedNet |
| mepesuccinato de omacetaxina | WHO MedNet |
| omacetaxine mepesuccinate | WHO MedNet |
| omacetaxini mepesuccinas | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2'R,3S,4S,5R)-(−)-homoharringtonine | ChEBI |
| Ceflatonin | ChEMBL |
| CGX-635 | ChemIDplus |
| Homoharringtonin | ChEMBL |
| (−)-homoharringtonine | ChEBI |
| Homoharringtonine | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Synribo | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4677 | DrugCentral |
| D08956 | KEGG DRUG |
| HMT | PDBeChem |
| LSM-3716 | LINCS |
| Omacetaxine_mepesuccinate | Wikipedia |
| US2010240887 | Patent |
| WO2007089878 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5687925 | Reaxys |
| CAS:26833-87-4 | KEGG DRUG |
| CAS:26833-87-4 | ChemIDplus |
| Citations |
|---|