EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO4 |
| Net Charge | 0 |
| Average Mass | 315.369 |
| Monoisotopic Mass | 315.14706 |
| SMILES | [H][C@]12c3cc4c(cc3CCN3CCC[C@@]31C=C(OC)[C@H]2O)OCO4 |
| InChI | InChI=1S/C18H21NO4/c1-21-15-9-18-4-2-5-19(18)6-3-11-7-13-14(23-10-22-13)8-12(11)16(18)17(15)20/h7-9,16-17,20H,2-6,10H2,1H3/t16-,17-,18+/m1/s1 |
| InChIKey | YMNCVRSYJBNGLD-KURKYZTESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephalotaxine (CHEBI:3540) is a benzazepine alkaloid (CHEBI:38523) |
| cephalotaxine (CHEBI:3540) is a benzazepine alkaloid fundamental parent (CHEBI:38527) |
| cephalotaxine (CHEBI:3540) is a cyclic acetal (CHEBI:59770) |
| cephalotaxine (CHEBI:3540) is a enol ether (CHEBI:47985) |
| cephalotaxine (CHEBI:3540) is a organic heteropentacyclic compound (CHEBI:38164) |
| cephalotaxine (CHEBI:3540) is a secondary alcohol (CHEBI:35681) |
| cephalotaxine (CHEBI:3540) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| omacetaxine mepesuccinate (CHEBI:71019) has functional parent cephalotaxine (CHEBI:3540) |
| IUPAC Name |
|---|
| cephalotaxine |
| Synonyms | Source |
|---|---|
| (1S,3aR,14bS)-2-methoxy-1,5,6,8,9,14b-hexahydro-4H-cyclopenta[a][1,3]dioxolo[4,5-h]pyrrolo[2,1-b][3]benzazepin-1-ol | IUPAC |
| (-)-Cephalotaxine | ChemIDplus |
| Cephalotaxine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:628324 | Reaxys |
| CAS:24316-19-6 | KEGG COMPOUND |
| CAS:24316-19-6 | ChemIDplus |