EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C12H15NO19S3)n.C8H15NO6 |
| Net Charge | -4 |
| Average Mass | 794.650 |
| Monoisotopic Mass | 794.03217 |
| SMILES | CC(=O)N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](OS(=O)(=O)[O-])[C@H](O[C@H]3[C@H](O)[C@@H](NS(=O)(=O)[O-])[C@@H](O)O[C@@H]3COS(=O)(=O)[O-])O[C@H]2C(=O)[O-])O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H34N2O25S3/c1-4(24)21-8-10(26)9(25)5(2-23)43-19(8)45-14-12(28)15(47-50(38,39)40)20(46-16(14)17(29)30)44-13-6(3-41-49(35,36)37)42-18(31)7(11(13)27)22-48(32,33)34/h5-16,18-20,22-23,25-28,31H,2-3H2,1H3,(H,21,24)(H,29,30)(H,32,33,34)(H,35,36,37)(H,38,39,40)/p-4/t5-,6-,7-,8-,9-,10-,11-,12+,13-,14+,15-,16-,18+,19-,20-/m1/s1 |
| InChIKey | UGAMAJKJZKYING-GSOQUUCNSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) is a carbohydrate acid derivative anion (CHEBI:63551) |
| heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) is a ionic polymer (CHEBI:60164) |
| heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) is a organic sulfamate oxoanion (CHEBI:61660) |
| heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) is conjugate base of heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) |
| Incoming Relation(s) |
| heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) is conjugate acid of heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) |
| Synonym | Source |
|---|---|
| heparan sulfate N-acetyl-α-D-glucosaminide anion | ChEBI |
| UniProt Name | Source |
|---|---|
| heparan sulfate N-acetyl-α-D-glucosaminide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Heparan-NAc-glucosaminide | MetaCyc |