EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C12H19NO19S3)n.C8H14NO6 |
| Net Charge | 0 |
| Average Mass | 797.674 |
| Monoisotopic Mass | 797.05345 |
| SMILES | *O[C@H]1O[C@H](COS(=O)(=O)O)[C@@H](O[C@@H]2O[C@@H](C(=O)O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3NC(C)=O)[C@H](O)[C@H]2OS(=O)(=O)O)[C@H](O)[C@H]1NS(=O)(=O)O |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) is a N-acetyl-α-D-glucosaminide (CHEBI:27425) |
| heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) is a heparan sulfates (CHEBI:35721) |
| heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) is a heparan α-D-glucosaminide (CHEBI:24495) |
| heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) is conjugate acid of heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) |
| Incoming Relation(s) |
| heparan sulfate N-acetyl-α-D-glucosaminide polyanion (CHEBI:70974) is conjugate base of heparan sulfate N-acetyl-α-D-glucosaminide (CHEBI:17421) |
| Synonym | Source |
|---|---|
| Heparan sulfate N-acetyl-alpha-D-glucosaminide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04649 | KEGG COMPOUND |