EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | Cn1cncc1CC(N)C(=O)O |
| InChI | InChI=1S/C7H11N3O2/c1-10-4-9-3-5(10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12) |
| InChIKey | JDHILDINMRGULE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24009031) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylhistidine (CHEBI:70959) has role human metabolite (CHEBI:77746) |
| 3-methylhistidine (CHEBI:70959) is a methylhistidine (CHEBI:137682) |
| 3-methylhistidine (CHEBI:70959) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 3-methylhistidine (CHEBI:70959) is tautomer of 3-methylhistidine zwitterion (CHEBI:133609) |
| Incoming Relation(s) |
| 3-methylhistidine zwitterion (CHEBI:133609) is tautomer of 3-methylhistidine (CHEBI:70959) |
| IUPAC Names |
|---|
| 3-methylhistidine |
| 2-amino-3-(1-methyl-1H-imidazol-5-yl)propanoic acid |
| Synonym | Source |
|---|---|
| 3-methyl-DL-histidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:83652 | Reaxys |
| Citations |
|---|