EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O2 |
| Net Charge | 0 |
| Average Mass | 169.184 |
| Monoisotopic Mass | 169.08513 |
| SMILES | Cn1cncc1CC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H11N3O2/c1-10-4-9-3-5(10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12) |
| InChIKey | JDHILDINMRGULE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylhistidine zwitterion (CHEBI:133609) has role human metabolite (CHEBI:77746) |
| 3-methylhistidine zwitterion (CHEBI:133609) is a α-amino-acid zwitterion (CHEBI:78608) |
| 3-methylhistidine zwitterion (CHEBI:133609) is tautomer of 3-methylhistidine (CHEBI:70959) |
| Incoming Relation(s) |
| 3-methylhistidine (CHEBI:70959) is tautomer of 3-methylhistidine zwitterion (CHEBI:133609) |
| IUPAC Name |
|---|
| 2-azaniumyl-3-(1-methyl-1H-imidazol-5-yl)propanoate |