EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N5O13P3 |
| Net Charge | -4 |
| Average Mass | 517.177 |
| Monoisotopic Mass | 516.98229 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])CP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C11H18N5O13P3/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(28-10)1-27-32(25,26)29-31(23,24)3-30(20,21)22/h2,4,6-7,10,17-18H,1,3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,12,14,15,19)/p-4/t4-,6-,7-,10-/m1/s1 |
| InChIKey | PHBDHXOBFUBCJD-KQYNXXCUSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) is a organophosphate oxoanion (CHEBI:58945) |
| guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) is a organophosphonate oxoanion (CHEBI:59635) |
| guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) is conjugate base of guanosine 5'-[β,γ-methylene]triphosphate (CHEBI:1963) |
| Incoming Relation(s) |
| trisodium guanosine 5'-[β,γ-methylene]triphosphate (CHEBI:68635) has part guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) |
| guanosine 5'-[β,γ-methylene]triphosphate (CHEBI:1963) is conjugate acid of guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) |
| IUPAC Name |
|---|
| 5'-O-({[(phosphonatomethyl)phosphinato]oxy}phosphinato)guanosine |
| Synonyms | Source |
|---|---|
| 5'-guanylylmethylenebisphosphonate(4−) | ChEBI |
| 5'-guanylylmethylenediphosphonate(4−) | ChEBI |
| GppCp(4−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11047236 | Reaxys |