EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N5O13P3 |
| Net Charge | 0 |
| Average Mass | 521.209 |
| Monoisotopic Mass | 521.01140 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C11H18N5O13P3/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(28-10)1-27-32(25,26)29-31(23,24)3-30(20,21)22/h2,4,6-7,10,17-18H,1,3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | PHBDHXOBFUBCJD-KQYNXXCUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanosine 5'-[β,γ-methylene]triphosphate (CHEBI:1963) is a nucleoside triphosphate analogue (CHEBI:37413) |
| guanosine 5'-[β,γ-methylene]triphosphate (CHEBI:1963) is conjugate acid of guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) |
| Incoming Relation(s) |
| guanosine 5'-[β,γ-methylene]triphosphate(4−) (CHEBI:70836) is conjugate base of guanosine 5'-[β,γ-methylene]triphosphate (CHEBI:1963) |
| IUPAC Name |
|---|
| 5'-O-(hydroxy{[hydroxy(phosphonomethyl)phosphoryl]oxy}phosphoryl)guanosine |
| Synonyms | Source |
|---|---|
| 5'-Guanosyl-methylene-triphosphate | KEGG COMPOUND |
| GppCp | ChEBI |
| 5'-Guanylylmethylenediphosphonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7559723 | Reaxys |
| CAS:13912-93-1 | ChemIDplus |