EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O5 |
| Net Charge | 0 |
| Average Mass | 276.288 |
| Monoisotopic Mass | 276.09977 |
| SMILES | [H][C@@]12COC(=O)[C@]3(CO3)[C@@]13C=C(C)[C@@H](C)[C@@]3([H])C=C2C(=O)O |
| InChI | InChI=1S/C15H16O5/c1-7-4-14-10(8(7)2)3-9(12(16)17)11(14)5-19-13(18)15(14)6-20-15/h3-4,8,10-11H,5-6H2,1-2H3,(H,16,17)/t8-,10-,11+,14-,15-/m1/s1 |
| InChIKey | NUPNVWUYFVEAIT-UJJBCWTCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 1.2.1.12 [glyceraldehyde-3-phosphate dehydrogenase (phosphorylating)] inhibitor An EC 1.2.1.* (oxidoreductase acting on donor aldehyde/oxo group with NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of glyceraldehyde-3-phosphate dehydrogenase (EC 1.2.1.12). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentalenolactone (CHEBI:70816) has role antimicrobial agent (CHEBI:33281) |
| pentalenolactone (CHEBI:70816) has role bacterial metabolite (CHEBI:76969) |
| pentalenolactone (CHEBI:70816) has role EC 1.2.1.12 [glyceraldehyde-3-phosphate dehydrogenase (phosphorylating)] inhibitor (CHEBI:70817) |
| pentalenolactone (CHEBI:70816) is a organic heterotricyclic compound (CHEBI:26979) |
| pentalenolactone (CHEBI:70816) is a sesquiterpene lactone (CHEBI:37667) |
| pentalenolactone (CHEBI:70816) is a spiro-epoxide (CHEBI:133131) |
| pentalenolactone (CHEBI:70816) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| pentalenolactone (CHEBI:70816) is conjugate acid of pentalenolactone(1−) (CHEBI:70790) |
| Incoming Relation(s) |
| pentalenolactone(1−) (CHEBI:70790) is conjugate base of pentalenolactone (CHEBI:70816) |
| IUPAC Name |
|---|
| (2R,4a'S,7'S,7a'R,9a'R)-6',7'-dimethyl-3'-oxo-1',7',7a',9a'-tetrahydrospiro[oxirane-2,4'-pentaleno[1,6a-c]pyran]-9'-carboxylic acid |
| Synonyms | Source |
|---|---|
| arenaemycin E | MetaCyc |
| Arenemycine | ChemIDplus |
| PA-132 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-13619 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:39567 | Reaxys |
| CAS:31501-48-1 | ChemIDplus |
| Citations |
|---|