EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | [H][C@@]12COC(=O)[C@@H](C)[C@@]13CC(C)(C)C[C@@]3([H])C=C2C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-8-13(18)19-6-11-10(12(16)17)4-9-5-14(2,3)7-15(8,9)11/h4,8-9,11H,5-7H2,1-3H3,(H,16,17)/t8-,9-,11+,15-/m1/s1 |
| InChIKey | MRLXXQBBRNRWDA-LIEMUPCESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentalenolactone D (CHEBI:70805) has role bacterial metabolite (CHEBI:76969) |
| pentalenolactone D (CHEBI:70805) is a organic heterotricyclic compound (CHEBI:26979) |
| pentalenolactone D (CHEBI:70805) is a sesquiterpene lactone (CHEBI:37667) |
| pentalenolactone D (CHEBI:70805) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| pentalenolactone D (CHEBI:70805) is conjugate acid of pentalenolactone D(1−) (CHEBI:70787) |
| Incoming Relation(s) |
| pentalenolactone D(1−) (CHEBI:70787) is conjugate base of pentalenolactone D (CHEBI:70805) |
| IUPAC Name |
|---|
| (4S,4aR,7aS,9aR)-4,6,6-trimethyl-3-oxo-1,3,4,5,6,7,7a,9a-octahydropentaleno[1,6a-c]pyran-9-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-13621 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5347613 | Reaxys |
| Citations |
|---|