EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21ClN2O2S |
| Net Charge | 0 |
| Average Mass | 376.909 |
| Monoisotopic Mass | 376.10123 |
| SMILES | Oc1cc2c(cc1O)CN(C(=S)NCCc1ccc(Cl)cc1)CCC2 |
| InChI | InChI=1S/C19H21ClN2O2S/c20-16-5-3-13(4-6-16)7-8-21-19(25)22-9-1-2-14-10-17(23)18(24)11-15(14)12-22/h3-6,10-11,23-24H,1-2,7-9,12H2,(H,21,25) |
| InChIKey | DRCMAZOSEIMCHM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | capsaicin receptor antagonist Any substance which blocks the painful sensation of heat caused by capsaicin acting on the TRPV1 ion channel. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsazepine (CHEBI:70773) has role capsaicin receptor antagonist (CHEBI:70774) |
| capsazepine (CHEBI:70773) is a benzazepine (CHEBI:35676) |
| capsazepine (CHEBI:70773) is a catechols (CHEBI:33566) |
| capsazepine (CHEBI:70773) is a monochlorobenzenes (CHEBI:83403) |
| capsazepine (CHEBI:70773) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,3,4,5-tetrahydro-2H-2-benzazepine-2-carbothioamide |
| Synonyms | Source |
|---|---|
| 2-[2-(4-chlorophenyl)ethylamino-thiocarbonyl]-7,8-dihydroxy-2,3,4,5-tetrahydro-1H-2-benzazepine | ChEBI |
| capsazepin | ChEBI |
| N-(2-[4-chlorophenyl]ethyl)-1,3,4,5-tetrahydro-7,8-dihydroxy-2H-2-benzazepine-2-carbothioamide | ChEBI |
| N-[2-(4-chlorophenyl)ethyl]-1,3,4,5-tetrahydro-7,8-dihydroxy-2H-2-benzazepine-2-carbothioamide | ChEBI |
| N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,3,4,5-tetrahydro-2H-2-benzazepine-2-carbothioamide | ChEBI |
| ST50826300 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Capsazepine | Wikipedia |
| LSM-2983 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7047754 | Reaxys |
| CAS:138977-28-3 | ChemIDplus |
| Citations |
|---|