EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O3 |
| Net Charge | 0 |
| Average Mass | 172.184 |
| Monoisotopic Mass | 172.08479 |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C7H12N2O3/c8-4-6(10)9-3-1-2-5(9)7(11)12/h5H,1-4,8H2,(H,11,12)/t5-/m0/s1 |
| InChIKey | KZNQNBZMBZJQJO-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Pro (CHEBI:70744) has functional parent L-proline (CHEBI:17203) |
| Gly-Pro (CHEBI:70744) has functional parent glycine (CHEBI:15428) |
| Gly-Pro (CHEBI:70744) has role metabolite (CHEBI:25212) |
| Gly-Pro (CHEBI:70744) is a dipeptide (CHEBI:46761) |
| Gly-Pro (CHEBI:70744) is tautomer of Gly-Pro zwitterion (CHEBI:73779) |
| Incoming Relation(s) |
| Gly-Pro zwitterion (CHEBI:73779) is tautomer of Gly-Pro (CHEBI:70744) |
| IUPAC Names |
|---|
| (2S)-1-(aminoacetyl)pyrrolidine-2-carboxylic acid |
| glycyl-L-proline |
| Synonyms | Source |
|---|---|
| 1-(Aminoacetyl)proline | HMDB |
| 1-Glycylproline | HMDB |
| N-glycylproline | HMDB |
| Glycylproline | ChemIDplus |
| Gly-L-Pro | ChEBI |
| GP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-10814 | MetaCyc |
| HMDB0000721 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:84046 | Reaxys |
| CAS:704-15-4 | ChemIDplus |
| Citations |
|---|