EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N8O5S4 |
| Net Charge | 0 |
| Average Mass | 604.721 |
| Monoisotopic Mass | 604.04395 |
| SMILES | [H][C@]12SCC(Sc3nc(-c4cc[n+](C)cc4)cs3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OCC)c1nsc(N)n1 |
| InChI | InChI=1S/C22H20N8O5S4/c1-3-35-27-13(16-26-21(23)39-28-16)17(31)25-14-18(32)30-15(20(33)34)12(9-36-19(14)30)38-22-24-11(8-37-22)10-4-6-29(2)7-5-10/h4-8,14,19H,3,9H2,1-2H3,(H3-,23,25,26,28,31,33,34)/b27-13-/t14-,19-/m1/s1 |
| InChIKey | RGFBRLNVZCCMSV-BIRGHMBHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftaroline (CHEBI:70729) has role antibacterial drug (CHEBI:36047) |
| ceftaroline (CHEBI:70729) has role antimicrobial agent (CHEBI:33281) |
| ceftaroline (CHEBI:70729) has role drug metabolite (CHEBI:49103) |
| ceftaroline (CHEBI:70729) is a 1,3-thiazoles (CHEBI:38418) |
| ceftaroline (CHEBI:70729) is a cephalosporin (CHEBI:23066) |
| ceftaroline (CHEBI:70729) is a iminium betaine (CHEBI:35285) |
| ceftaroline (CHEBI:70729) is a oxime O-ether (CHEBI:36816) |
| ceftaroline (CHEBI:70729) is a thiadiazoles (CHEBI:38099) |
| Incoming Relation(s) |
| ceftaroline fosamil (CHEBI:70718) has functional parent ceftaroline (CHEBI:70729) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(ethoxyimino)acetyl]amino}-3-{[4-(1-methylpyridinium-4-yl)-1,3-thiazol-2-yl]sulfanyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| Synonyms | Source |
|---|---|
| PPI 0903M | ChemIDplus |
| T 91825 | ChemIDplus |
| T-91825 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9532372 | Reaxys |
| CAS:189345-04-8 | ChemIDplus |
| Citations |
|---|