EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N8O8PS4 |
| Net Charge | 0 |
| Average Mass | 684.700 |
| Monoisotopic Mass | 684.01028 |
| SMILES | [H][C@]12SCC(Sc3nc(-c4cc[n+](C)cc4)cs3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OCC)c1nsc(NP(=O)(O)O)n1 |
| InChI | InChI=1S/C22H21N8O8PS4/c1-3-38-26-13(16-25-21(43-28-16)27-39(35,36)37)17(31)24-14-18(32)30-15(20(33)34)12(9-40-19(14)30)42-22-23-11(8-41-22)10-4-6-29(2)7-5-10/h4-8,14,19H,3,9H2,1-2H3,(H4-,24,25,27,28,31,33,34,35,36,37)/b26-13-/t14-,19-/m1/s1 |
| InChIKey | ZCCUWMICIWSJIX-NQJJCJBVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftaroline fosamil (CHEBI:70718) has functional parent ceftaroline (CHEBI:70729) |
| ceftaroline fosamil (CHEBI:70718) has role antibacterial drug (CHEBI:36047) |
| ceftaroline fosamil (CHEBI:70718) has role antimicrobial agent (CHEBI:33281) |
| ceftaroline fosamil (CHEBI:70718) has role prodrug (CHEBI:50266) |
| ceftaroline fosamil (CHEBI:70718) is a 1,3-thiazoles (CHEBI:38418) |
| ceftaroline fosamil (CHEBI:70718) is a cephalosporin (CHEBI:23066) |
| ceftaroline fosamil (CHEBI:70718) is a iminium betaine (CHEBI:35285) |
| ceftaroline fosamil (CHEBI:70718) is a organic phosphoramidate (CHEBI:37773) |
| ceftaroline fosamil (CHEBI:70718) is a oxime O-ether (CHEBI:36816) |
| ceftaroline fosamil (CHEBI:70718) is a thiadiazoles (CHEBI:38099) |
| Incoming Relation(s) |
| ceftaroline fosamil acetate (CHEBI:70715) has part ceftaroline fosamil (CHEBI:70718) |
| IUPAC Name |
|---|
| 7-({(2Z)-2-(ethoxyimino)-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl}amino)-3-{[4-(1-methylpyridinium-4-yl)-1,3-thiazol-2-yl]sulfanyl}-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| ceftarolina fosamilo | WHO MedNet |
| ceftaroline fosamil | WHO MedNet |
| ceftaroline fosamil | WHO MedNet |
| ceftarolinum fosamilum | WHO MedNet |
| Synonym | Source |
|---|---|
| (6R,7R)-7-({(2Z)-2-(ethoxyimino)-2-[5-(phosphonoamino)-1,2,4-thiadiazol-3-yl]acetyl}amino)-3-{[4-(1-methylpyridinium-4-yl)-1,3-thiazol-2-yl]sulfanyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 4169 | DrugCentral |
| Ceftaroline_fosamil | Wikipedia |
| MX2012003411 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9535806 | Reaxys |
| CAS:229016-73-3 | ChemIDplus |
| Citations |
|---|