EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO |
| Net Charge | 0 |
| Average Mass | 191.274 |
| Monoisotopic Mass | 191.13101 |
| SMILES | CCN(CC)C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | MMOXZBCLCQITDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-diethyl-m-toluamide (CHEBI:7071) has functional parent m-toluic acid (CHEBI:10589) |
| N,N-diethyl-m-toluamide (CHEBI:7071) has role environmental contaminant (CHEBI:78298) |
| N,N-diethyl-m-toluamide (CHEBI:7071) has role insect repellent (CHEBI:71692) |
| N,N-diethyl-m-toluamide (CHEBI:7071) has role xenobiotic (CHEBI:35703) |
| N,N-diethyl-m-toluamide (CHEBI:7071) is a benzamides (CHEBI:22702) |
| N,N-diethyl-m-toluamide (CHEBI:7071) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N,N-diethyl-3-methylbenzamide |
| INNs | Source |
|---|---|
| diethyltoluamidum | WHO MedNet |
| diethyltoluamide | WHO MedNet |
| dietiltoluamida | WHO MedNet |
| diéthyltoluamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| DEET | KEGG COMPOUND |
| diethyl toluamide | ChemIDplus |
| 3-methyl-N,N-diethylbenzamide | ChemIDplus |
| deet | ChEBI |
| Brand Names | Source |
|---|---|
| Muscol | ChEBI |
| Autan | ChemIDplus |
| Detamide | ChemIDplus |
| Repel | ChemIDplus |
| Flypel | ChemIDplus |
| Off | ChemIDplus |
| Citations |
|---|