EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O2 |
| Net Charge | 0 |
| Average Mass | 136.150 |
| Monoisotopic Mass | 136.05243 |
| SMILES | Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | GPSDUZXPYCFOSQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-toluic acid (CHEBI:10589) has role human xenobiotic metabolite (CHEBI:76967) |
| m-toluic acid (CHEBI:10589) is a methylbenzoic acid (CHEBI:25280) |
| m-toluic acid (CHEBI:10589) is conjugate acid of m-toluate (CHEBI:28795) |
| Incoming Relation(s) |
| N,N-diethyl-m-toluamide (CHEBI:7071) has functional parent m-toluic acid (CHEBI:10589) |
| m-toluate (CHEBI:28795) is conjugate base of m-toluic acid (CHEBI:10589) |
| IUPAC Name |
|---|
| 3-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| 3-toluic acid | ChemIDplus |
| beta-Bethylbenzoic acid | KEGG COMPOUND |
| beta-Methylbenzoic acid | ChemIDplus |
| meta-Toluic acid | ChemIDplus |
| m-Toluic Acid | KEGG COMPOUND |
| m-Toluylic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07211 | KEGG COMPOUND |
| CPD-8775 | MetaCyc |
| M-Toluic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:970526 | Reaxys |
| CAS:99-04-7 | ChemIDplus |
| CAS:99-04-7 | KEGG COMPOUND |
| Citations |
|---|