EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1c2c(c3c(oc4c(OC)cccc43)c1OC)OCO2 |
| InChI | InChI=1S/C16H14O6/c1-17-9-6-4-5-8-10-12-16(21-7-20-12)15(19-3)14(18-2)13(10)22-11(8)9/h4-6H,7H2,1-3H3 |
| InChIKey | SUYTZNXJVBRFQQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhaphiolepis indica var. tashiroi (ncbitaxon:36624) | root (BTO:0001188) | DOI (10.1021/np100200s) | Cold methanolic extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-Methylenedioxy-3,4,6-trimethoxydibenzofuran (CHEBI:70630) has role metabolite (CHEBI:25212) |
| 1,2-Methylenedioxy-3,4,6-trimethoxydibenzofuran (CHEBI:70630) is a dibenzofurans (CHEBI:38922) |