EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2 |
| Net Charge | 0 |
| Average Mass | 146.193 |
| Monoisotopic Mass | 146.08440 |
| SMILES | c1cncc(C2=NCCC2)c1 |
| InChI | InChI=1S/C9H10N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7H,2,4,6H2 |
| InChIKey | DPNGWXJMIILTBS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana tabacum (ncbitaxon:4097) | - | PubMed (18136963) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myosmine (CHEBI:7051) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| myosmine (CHEBI:7051) has role mutagen (CHEBI:25435) |
| myosmine (CHEBI:7051) has role plant metabolite (CHEBI:76924) |
| myosmine (CHEBI:7051) is a pyridine alkaloid (CHEBI:26416) |
| myosmine (CHEBI:7051) is a pyrroline (CHEBI:23763) |
| Incoming Relation(s) |
| 6-hydroxymyosmine (CHEBI:189660) has functional parent myosmine (CHEBI:7051) |
| IUPAC Name |
|---|
| 3-(3,4-dihydro-2H-pyrrol-5-yl)pyridine |
| Synonyms | Source |
|---|---|
| 2-(3-pyridyl)-1-pyrroline | ChEBI |
| 3-(1-pyrrolin-2-yl)pyridine | ChemIDplus |
| Citations |
|---|