EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O |
| Net Charge | 0 |
| Average Mass | 162.192 |
| Monoisotopic Mass | 162.07931 |
| SMILES | Oc1ccc(C2=NCCC2)cn1 |
| InChI | InChI=1S/C9H10N2O/c12-9-4-3-7(6-11-9)8-2-1-5-10-8/h3-4,6H,1-2,5H2,(H,11,12) |
| InChIKey | QYPBKLSPFWOREG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Shinella sp. HZN7 (ncbitaxon:879274) | - | PubMed (27568381) |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxymyosmine (CHEBI:189660) has functional parent myosmine (CHEBI:7051) |
| 6-hydroxymyosmine (CHEBI:189660) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 6-hydroxymyosmine (CHEBI:189660) is a monohydroxypyridine (CHEBI:38182) |
| 6-hydroxymyosmine (CHEBI:189660) is a pyrroline (CHEBI:23763) |
| IUPAC Name |
|---|
| 5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-ol |
| Synonym | Source |
|---|---|
| 5-(3,4-dihydro-2H-pyrrol-5-yl)-2-pyridinol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 6-hydroxymyosmine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 35476177 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:70969-38-9 | ChemIDplus |
| Citations |
|---|