EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O5 |
| Net Charge | 0 |
| Average Mass | 482.661 |
| Monoisotopic Mass | 482.30322 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C(=O)OC)[C@@]1(C)CC(=O)C1=C2C(=O)C[C@@]2([H])[C@H](C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C30H42O5/c1-16(18(3)28(34)35-7)8-9-17(2)20-10-11-21-26-24(32)14-22-19(4)23(31)12-13-29(22,5)27(26)25(33)15-30(20,21)6/h17-22H,1,8-15H2,2-7H3/t17-,18?,19+,20-,21+,22+,29+,30-/m1/s1 |
| InChIKey | NZJIIJSJLBIJDO-RTMVVRFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zhankuic acid A methyl ester (CHEBI:70310) has functional parent zhankuic acid A (CHEBI:66503) |
| zhankuic acid A methyl ester (CHEBI:70310) has role plant metabolite (CHEBI:76924) |
| zhankuic acid A methyl ester (CHEBI:70310) is a 11-oxo steroid (CHEBI:47787) |
| zhankuic acid A methyl ester (CHEBI:70310) is a 3-oxo steroid (CHEBI:47788) |
| zhankuic acid A methyl ester (CHEBI:70310) is a 7-oxo steroid (CHEBI:47789) |
| zhankuic acid A methyl ester (CHEBI:70310) is a ergostanoid (CHEBI:50403) |
| zhankuic acid A methyl ester (CHEBI:70310) is a steroid ester (CHEBI:47880) |
| IUPAC Name |
|---|
| methyl (4α,5α)-4-methyl-3,7,11-trioxoergosta-8,24(28)-dien-26-oate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21087037 | Reaxys |
| Citations |
|---|