EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O5 |
| Net Charge | 0 |
| Average Mass | 468.634 |
| Monoisotopic Mass | 468.28757 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C(=O)O)[C@@]1(C)CC(=O)C1=C2C(=O)C[C@@]2([H])[C@H](C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C29H40O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h16-21H,1,7-14H2,2-6H3,(H,33,34)/t16-,17?,18+,19-,20+,21+,28+,29-/m1/s1 |
| InChIKey | DVORYMAGXQGBQK-QCMFUGJUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | |||
| fruit body (BTO:0000487) | PubMed (8594142) | ||
| fruit body (BTO:0000487) | PubMed (15095145) | ||
| fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zhankuic acid A (CHEBI:66503) has role anti-inflammatory agent (CHEBI:67079) |
| zhankuic acid A (CHEBI:66503) has role antineoplastic agent (CHEBI:35610) |
| zhankuic acid A (CHEBI:66503) has role plant metabolite (CHEBI:76924) |
| zhankuic acid A (CHEBI:66503) is a 11-oxo steroid (CHEBI:47787) |
| zhankuic acid A (CHEBI:66503) is a 3-oxo steroid (CHEBI:47788) |
| zhankuic acid A (CHEBI:66503) is a 7-oxo steroid (CHEBI:47789) |
| zhankuic acid A (CHEBI:66503) is a ergostanoid (CHEBI:50403) |
| zhankuic acid A (CHEBI:66503) is a monocarboxylic acid (CHEBI:25384) |
| zhankuic acid A (CHEBI:66503) is a steroid acid (CHEBI:47891) |
| Incoming Relation(s) |
| zhankuic acid A methyl ester (CHEBI:70310) has functional parent zhankuic acid A (CHEBI:66503) |
| IUPAC Name |
|---|
| (4α,5α)-4-methyl-3,7,11-trioxoergosta-8,24(28)-dien-26-oic acid |
| Synonym | Source |
|---|---|
| 4α-methylergosta-8,24(28)-dien-3,7,11-trione-26-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9824952 | Reaxys |
| Citations |
|---|