EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O10 |
| Net Charge | 0 |
| Average Mass | 442.376 |
| Monoisotopic Mass | 442.09000 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21-/m1/s1 |
| InChIKey | LSHVYAFMTMFKBA-TZIWHRDSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21080642) | Ethanolic extract of air-dried, powdered bark |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) has functional parent (−)-epicatechin (CHEBI:90) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) has functional parent gallic acid (CHEBI:30778) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) has role metabolite (CHEBI:25212) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) is a catechin (CHEBI:23053) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) is a gallate ester (CHEBI:37576) |
| (−)-epicatechin-3-O-gallate (CHEBI:70255) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| Synonyms | Source |
|---|---|
| 3-O-galloylepicatechin | HMDB |
| 3-gallate(−)-epicatechol | HMDB |
| ECG | HMDB |
| (−)-cis-3,3',4',5,7-pentahydroxyflavane 3-gallate | HMDB |
| Teatannin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Epicatechin_gallate | Wikipedia |
| HMDB0037944 | HMDB |
| LSM-3115 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:65603 | Reaxys |
| CAS:1257-08-5 | ChemIDplus |
| Citations |
|---|