EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44O9 |
| Net Charge | 0 |
| Average Mass | 500.629 |
| Monoisotopic Mass | 500.29853 |
| SMILES | [H][C@@]1([C@@H](C)[C@H](C)O)O[C@@]1([H])C[C@H]1CO[C@@H](C/C(C)=C/C(=O)OCCCCCCCCC(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H44O9/c1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(28)29)12-20-25(32)24(31)19(15-34-20)14-21-26(35-21)17(2)18(3)27/h13,17-21,24-27,31-32H,4-12,14-15H2,1-3H3,(H,28,29)/b16-13+/t17-,18-,19-,20-,21-,24+,25-,26-/m0/s1 |
| InChIKey | MINDHVHHQZYEEK-HBBNESRFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mupirocin (CHEBI:7025) has role antibacterial drug (CHEBI:36047) |
| mupirocin (CHEBI:7025) has role bacterial metabolite (CHEBI:76969) |
| mupirocin (CHEBI:7025) has role protein synthesis inhibitor (CHEBI:48001) |
| mupirocin (CHEBI:7025) is a epoxide (CHEBI:32955) |
| mupirocin (CHEBI:7025) is a monocarboxylic acid (CHEBI:25384) |
| mupirocin (CHEBI:7025) is a oxanes (CHEBI:46942) |
| mupirocin (CHEBI:7025) is a secondary alcohol (CHEBI:35681) |
| mupirocin (CHEBI:7025) is a triol (CHEBI:27136) |
| mupirocin (CHEBI:7025) is a α,β-unsaturated carboxylic ester (CHEBI:51737) |
| mupirocin (CHEBI:7025) is conjugate acid of mupirocin(1−) (CHEBI:145790) |
| Incoming Relation(s) |
| mupirocin(1−) (CHEBI:145790) is conjugate base of mupirocin (CHEBI:7025) |
| IUPAC Name |
|---|
| 9-({(2E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-({(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl}methyl)tetrahydro-2H-pyran-2-yl]-3-methylbut-2-enoyl}oxy)nonanoic acid |
| INNs | Source |
|---|---|
| mupirocin | WHO MedNet |
| mupirocina | WHO MedNet |
| mupirocine | WHO MedNet |
| mupirocinum | WHO MedNet |
| Synonym | Source |
|---|---|
| Pseudomonic acid A | ChemIDplus |
| Brand Names | Source |
|---|---|
| Bactroban | ChemIDplus |
| Centany | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:12650-69-0 | KEGG COMPOUND |
| CAS:12650-69-0 | ChemIDplus |
| Citations |
|---|