EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43O9 |
| Net Charge | -1 |
| Average Mass | 499.621 |
| Monoisotopic Mass | 499.29126 |
| SMILES | [H][C@@]1([C@@H](C)[C@H](C)O)O[C@@]1([H])C[C@H]1CO[C@@H](C/C(C)=C/C(=O)OCCCCCCCCC(=O)[O-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H44O9/c1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(28)29)12-20-25(32)24(31)19(15-34-20)14-21-26(35-21)17(2)18(3)27/h13,17-21,24-27,31-32H,4-12,14-15H2,1-3H3,(H,28,29)/p-1/b16-13+/t17-,18-,19-,20-,21-,24+,25-,26-/m0/s1 |
| InChIKey | MINDHVHHQZYEEK-HBBNESRFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mupirocin(1−) (CHEBI:145790) is a monocarboxylic acid anion (CHEBI:35757) |
| mupirocin(1−) (CHEBI:145790) is conjugate base of mupirocin (CHEBI:7025) |
| Incoming Relation(s) |
| mupirocin calcium (anhydrous) (CHEBI:145818) has part mupirocin(1−) (CHEBI:145790) |
| mupirocin (CHEBI:7025) is conjugate acid of mupirocin(1−) (CHEBI:145790) |
| IUPAC Name |
|---|
| 9-({(2E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-({(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl}methyl)tetrahydro-2H-pyran-2-yl]-3-methylbut-2-enoyl}oxy)nonanoate |