EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2O4 |
| Net Charge | 0 |
| Average Mass | 268.228 |
| Monoisotopic Mass | 268.04841 |
| SMILES | O=C(O)c1cccc2nc3c(C(=O)O)cccc3nc12 |
| InChI | InChI=1S/C14H8N2O4/c17-13(18)7-3-1-5-9-11(7)16-10-6-2-4-8(14(19)20)12(10)15-9/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | MJALVONLCNWZHK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia lata (ncbitaxon:482957) | - | PubMed (23897464) | Strain: 383 |
| Dermacoccus abyssi (ncbitaxon:322596) | - | PubMed (20448892) | |
| Erwinia herbicola (ncbitaxon:549) | - | PubMed (12139622) | Strain: Eh1087 |
| Pseudomonas fluorescens (ncbitaxon:294) | - | PubMed (23897464) | Strain: 2-79 |
| Streptomyces sp. (ncbitaxon:1931) | mycelium (BTO:0001436) | PubMed (21090727) | EtOAc soluble portion of acetone extract of mycelia and ethyl acetate extract of culture broth Strain: IFM 11204 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenazine-1,6-dicarboxylic acid (CHEBI:70231) has role bacterial metabolite (CHEBI:76969) |
| phenazine-1,6-dicarboxylic acid (CHEBI:70231) is a dicarboxylic acid (CHEBI:35692) |
| phenazine-1,6-dicarboxylic acid (CHEBI:70231) is a phenazines (CHEBI:39201) |
| phenazine-1,6-dicarboxylic acid (CHEBI:70231) is conjugate acid of phenazine-1,6-dicarboxylate (CHEBI:131980) |
| Incoming Relation(s) |
| phenazine-1,6-dicarboxylate (CHEBI:131980) is conjugate base of phenazine-1,6-dicarboxylic acid (CHEBI:70231) |
| Synonyms | Source |
|---|---|
| 1,6-Phenazinedicarboxylic acid | ChemIDplus |
| Phenazine-1,6-dicarboxylic acid | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:250191 | Reaxys |
| CAS:23462-25-1 | ChemIDplus |
| CAS:23462-25-1 | KEGG COMPOUND |
| Citations |
|---|