EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H16N4O6 |
| Net Charge | 0 |
| Average Mass | 468.425 |
| Monoisotopic Mass | 468.10698 |
| SMILES | [H][C@@]12Cc3nc4cccc(O)c4nc3[C@@H](O)[C@]1([H])Oc1cc(C(=O)O)c3nc4cccc(O)c4nc3c12 |
| InChI | InChI=1S/C25H16N4O6/c30-14-5-1-3-11-19(14)28-21-13(26-11)7-9-17-16(35-24(9)23(21)32)8-10(25(33)34)18-22(17)29-20-12(27-18)4-2-6-15(20)31/h1-6,8-9,23-24,30-32H,7H2,(H,33,34)/t9-,23+,24+/m0/s1 |
| InChIKey | LUHDREMZHBQHFC-MLIBEQFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | mycelium (BTO:0001436) | PubMed (21090727) | EtOAc soluble portion of acetone extract of mycelia and ethyl acetate extract of culture broth Strain: IFM 11204 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Izumiphenazine A, (rel)- (CHEBI:70228) has role metabolite (CHEBI:25212) |
| Izumiphenazine A, (rel)- (CHEBI:70228) is a phenazines (CHEBI:39201) |
| Citations |
|---|