EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | CC[C@H](C)C(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C11H14O4/c1-3-6(2)11(15)10-8(13)4-7(12)5-9(10)14/h4-6,12-14H,3H2,1-2H3/t6-/m0/s1 |
| InChIKey | ASABIRFQGVWRDC-LURJTMIESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multifidol (CHEBI:7020) has functional parent phloroglucinol (CHEBI:16204) |
| multifidol (CHEBI:7020) has role metabolite (CHEBI:25212) |
| multifidol (CHEBI:7020) is a benzenetriol (CHEBI:22707) |
| multifidol (CHEBI:7020) is a butanone (CHEBI:22951) |
| Incoming Relation(s) |
| multifidol glucoside (CHEBI:68339) has functional parent multifidol (CHEBI:7020) |
| IUPAC Name |
|---|
| (2S)-2-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one |
| Synonyms | Source |
|---|---|
| 2-methylbutanoyl phloroglucinol | ChEBI |
| (S)-2-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one | ChEBI |
| (S)-(+)-(2-methylbutyryl)phloroglucinol | ChEBI |