EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:68339 - multifidol glucoside
| Formula | C17H24O9 |
| Net Charge | 0 |
| Average Mass | 372.370 |
| Monoisotopic Mass | 372.14203 |
| SMILES | CC[C@H](C)C(=O)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O9/c1-3-7(2)13(21)12-9(20)4-8(19)5-10(12)25-17-16(24)15(23)14(22)11(6-18)26-17/h4-5,7,11,14-20,22-24H,3,6H2,1-2H3/t7-,11+,14+,15-,16+,17+/m0/s1 |
| InChIKey | MMJKSUJYDHTZJV-WVSKRKQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multifidol glucoside (CHEBI:68339) has functional parent multifidol (CHEBI:7020) |
| multifidol glucoside (CHEBI:68339) has role anti-inflammatory agent (CHEBI:67079) |
| multifidol glucoside (CHEBI:68339) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| multifidol glucoside (CHEBI:68339) has role metabolite (CHEBI:25212) |
| multifidol glucoside (CHEBI:68339) is a butanone (CHEBI:22951) |
| multifidol glucoside (CHEBI:68339) is a monosaccharide derivative (CHEBI:63367) |
| multifidol glucoside (CHEBI:68339) is a resorcinols (CHEBI:33572) |
| multifidol glucoside (CHEBI:68339) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-[(2S)-2-methylbutanoyl]phenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6983743 | Reaxys |
| Citations |
|---|