EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O9 |
| Net Charge | 0 |
| Average Mass | 372.370 |
| Monoisotopic Mass | 372.14203 |
| SMILES | CC[C@H](C)C(=O)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O9/c1-3-7(2)13(21)12-9(20)4-8(19)5-10(12)25-17-16(24)15(23)14(22)11(6-18)26-17/h4-5,7,11,14-20,22-24H,3,6H2,1-2H3/t7-,11+,14+,15-,16+,17+/m0/s1 |
| InChIKey | MMJKSUJYDHTZJV-WVSKRKQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multifidol glucoside (CHEBI:68339) has functional parent multifidol (CHEBI:7020) |
| multifidol glucoside (CHEBI:68339) has role anti-inflammatory agent (CHEBI:67079) |
| multifidol glucoside (CHEBI:68339) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| multifidol glucoside (CHEBI:68339) has role metabolite (CHEBI:25212) |
| multifidol glucoside (CHEBI:68339) is a butanone (CHEBI:22951) |
| multifidol glucoside (CHEBI:68339) is a monosaccharide derivative (CHEBI:63367) |
| multifidol glucoside (CHEBI:68339) is a resorcinols (CHEBI:33572) |
| multifidol glucoside (CHEBI:68339) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-[(2S)-2-methylbutanoyl]phenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6983743 | Reaxys |
| Citations |
|---|