EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:70082 - myricitrin
| Formula | C21H20O12 |
| Net Charge | 0 |
| Average Mass | 464.379 |
| Monoisotopic Mass | 464.09548 |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O12/c1-6-14(26)17(29)18(30)21(31-6)33-20-16(28)13-9(23)4-8(22)5-12(13)32-19(20)7-2-10(24)15(27)11(25)3-7/h2-6,14,17-18,21-27,29-30H,1H3/t6-,14-,17+,18+,21-/m0/s1 |
| InChIKey | DCYOADKBABEMIQ-OWMUPTOHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrica cerifera (ncbitaxon:3510) | root (BTO:0001188) | PubMed (21141876) | Previous component: root bark; Toluene extract of raw-bayberry root-bark powder |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myricitrin (CHEBI:70082) has functional parent myricetin (CHEBI:18152) |
| myricitrin (CHEBI:70082) has role anti-allergic agent (CHEBI:50857) |
| myricitrin (CHEBI:70082) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| myricitrin (CHEBI:70082) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| myricitrin (CHEBI:70082) has role plant metabolite (CHEBI:76924) |
| myricitrin (CHEBI:70082) is a glycosyloxyflavone (CHEBI:50018) |
| myricitrin (CHEBI:70082) is a monosaccharide derivative (CHEBI:63367) |
| myricitrin (CHEBI:70082) is a pentahydroxyflavone (CHEBI:25883) |
| myricitrin (CHEBI:70082) is a α-L-rhamnoside (CHEBI:27848) |
| myricitrin (CHEBI:70082) is conjugate acid of myricitrin(1−) (CHEBI:144432) |
| Incoming Relation(s) |
| myricitrin-5-methyl ether (CHEBI:66423) has functional parent myricitrin (CHEBI:70082) |
| myricitrin(1−) (CHEBI:144432) is conjugate base of myricitrin (CHEBI:70082) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| 3-((6-deoxy-α-L-mannopyranosyl)oxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-benzopyran-4-one | ChEBI |
| myricetin 3-O-α-L-rhamnopyranoside | ChEBI |
| Myricetin 3-O-rhamnoside | KEGG COMPOUND |
| Myricitrin | KEGG COMPOUND |
| Myricitroside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00005730 | KNApSAcK |
| C10108 | KEGG COMPOUND |
| HMDB0034360 | HMDB |
| LMPK12112436 | LIPID MAPS |
| Myricitrin | Wikipedia |
| US2012015090 | Patent |
| WO2010110334 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:69806 | Reaxys |
| CAS:17912-87-7 | ChemIDplus |
| CAS:17912-87-7 | KEGG COMPOUND |
| Citations |
|---|