EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O12 |
| Net Charge | 0 |
| Average Mass | 464.379 |
| Monoisotopic Mass | 464.09548 |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O12/c1-6-14(26)17(29)18(30)21(31-6)33-20-16(28)13-9(23)4-8(22)5-12(13)32-19(20)7-2-10(24)15(27)11(25)3-7/h2-6,14,17-18,21-27,29-30H,1H3/t6-,14-,17+,18+,21-/m0/s1 |
| InChIKey | DCYOADKBABEMIQ-OWMUPTOHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrica cerifera (ncbitaxon:3510) | root (BTO:0001188) | PubMed (21141876) | Previous component: root bark; Toluene extract of raw-bayberry root-bark powder |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). |
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myricitrin (CHEBI:70082) has functional parent myricetin (CHEBI:18152) |
| myricitrin (CHEBI:70082) has role anti-allergic agent (CHEBI:50857) |
| myricitrin (CHEBI:70082) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| myricitrin (CHEBI:70082) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| myricitrin (CHEBI:70082) has role plant metabolite (CHEBI:76924) |
| myricitrin (CHEBI:70082) is a glycosyloxyflavone (CHEBI:50018) |
| myricitrin (CHEBI:70082) is a monosaccharide derivative (CHEBI:63367) |
| myricitrin (CHEBI:70082) is a pentahydroxyflavone (CHEBI:25883) |
| myricitrin (CHEBI:70082) is a α-L-rhamnoside (CHEBI:27848) |
| myricitrin (CHEBI:70082) is conjugate acid of myricitrin(1−) (CHEBI:144432) |
| Incoming Relation(s) |
| myricitrin-5-methyl ether (CHEBI:66423) has functional parent myricitrin (CHEBI:70082) |
| myricitrin(1−) (CHEBI:144432) is conjugate base of myricitrin (CHEBI:70082) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| 3-((6-deoxy-α-L-mannopyranosyl)oxy)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-benzopyran-4-one | ChEBI |
| myricetin 3-O-α-L-rhamnopyranoside | ChEBI |
| Myricetin 3-O-rhamnoside | KEGG COMPOUND |
| Myricitrin | KEGG COMPOUND |
| Myricitroside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00005730 | KNApSAcK |
| C10108 | KEGG COMPOUND |
| HMDB0034360 | HMDB |
| LMPK12112436 | LIPID MAPS |
| Myricitrin | Wikipedia |
| US2012015090 | Patent |
| WO2010110334 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:69806 | Reaxys |
| CAS:17912-87-7 | ChemIDplus |
| CAS:17912-87-7 | KEGG COMPOUND |
| Citations |
|---|