EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O12 |
| Net Charge | 0 |
| Average Mass | 478.406 |
| Monoisotopic Mass | 478.11113 |
| SMILES | COc1cc(O)cc2oc(-c3cc(O)c(O)c(O)c3)c(O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)c(=O)c12 |
| InChI | InChI=1S/C22H22O12/c1-7-15(26)18(29)19(30)22(32-7)34-21-17(28)14-12(31-2)5-9(23)6-13(14)33-20(21)8-3-10(24)16(27)11(25)4-8/h3-7,15,18-19,22-27,29-30H,1-2H3/t7-,15-,18+,19+,22-/m0/s1 |
| InChIKey | LPVCLSBWFKENQA-FDNTWFBCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron yedoense var. poukhanense (ncbitaxon:224354) | flower (BTO:0000469) | PubMed (17366733) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myricitrin-5-methyl ether (CHEBI:66423) has functional parent myricitrin (CHEBI:70082) |
| myricitrin-5-methyl ether (CHEBI:66423) has role antioxidant (CHEBI:22586) |
| myricitrin-5-methyl ether (CHEBI:66423) has role metabolite (CHEBI:25212) |
| myricitrin-5-methyl ether (CHEBI:66423) is a glycosyloxyflavone (CHEBI:50018) |
| myricitrin-5-methyl ether (CHEBI:66423) is a monomethoxyflavone (CHEBI:25401) |
| myricitrin-5-methyl ether (CHEBI:66423) is a monosaccharide derivative (CHEBI:63367) |
| myricitrin-5-methyl ether (CHEBI:66423) is a tetrahydroxyflavone (CHEBI:38684) |
| myricitrin-5-methyl ether (CHEBI:66423) is a α-L-rhamnoside (CHEBI:27848) |
| Synonyms | Source |
|---|---|
| 3,7,3',4',5'-pentahydroxy-5-methoxyflavone-3-O-α-L-rhamnopyranoside | ChEBI |
| 7-hydroxy-5-methoxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside | ChEBI |
| Citations |
|---|